3,3-Dimethyl-1,5-dioxonane-6,9-dione

Reputable manufacturer supply 3,3-Dimethyl-1,5-dioxonane-6,9-dione 7445-18-3 in stock with high standard We provide high quality 3,3-Dimethyl-1,5-dioxonane-6,9-dione (CAS 7445-18-3), at a very affordable prices to our customers.

1.What is the 3,3-Dimethyl-1,5-dioxonane-6,9-dione ?

3,3-Dimethyl-1,5-dioxonane-6,9-dione, also known as 1,5-Dioxaspiro[5.5]undecane-6,9-dione, is a cyclic ketone with the molecular formula C9H14O4. This organic compound features a spiro structure, which consists of two rings sharing a common atom. In this case, the two rings are a five-membered and a six-membered ring, with the common atom being the oxygen atom at position 1. The compound has two methyl groups attached to the carbon atoms at positions 3 and 3', and two carbonyl groups at positions 6 and 9. Due to its unique structure, 3,3-Dimethyl-1,5-dioxonane-6,9-dione has potential applications in various fields, such as pharmaceuticals and chemical synthesis.

2.What is the CAS number for 3,3-Dimethyl-1,5-dioxonane-6,9-dione ?

The CAS number of 3,3-Dimethyl-1,5-dioxonane-6,9-dione is 7445-18-3.

More information of 3,3-Dimethyl-1,5-dioxonane-6,9-dione 7445-18-3 are:

3.What is the molecular formula of 3,3-Dimethyl-1,5-dioxonane-6,9-dione ?

The chemical formula of?3,3-Dimethyl-1,5-dioxonane-6,9-dione is C9H14O4 which containing 9 Carbon atoms,14 Hydrogen atoms and 4 Oxygen atoms,and the molecular weight, and the molecular weight of 3,3-Dimethyl-1,5-dioxonane-6,9-dione is 186.2051

4.What is 3,3-Dimethyl-1,5-dioxonane-6,9-dione(7445-18-3)used for?

3,3-Dimethyl-1,5-dioxonane-6,9-dione, also known as 1,5-Dioxaspiro[5.5]undecane-6,9-dione, is a cyclic ketone with the molecular formula C9H14O4. This organic compound features a spiro structure, which consists of two rings sharing a common atom. In this case, the two rings are a five-membered and a six-membered ring, with the common atom being the oxygen atom at position 1. The compound has two methyl groups attached to the carbon atoms at positions 3 and 3', and two carbonyl groups at positions 6 and 9. Due to its unique structure, 3,3-Dimethyl-1,5-dioxonane-6,9-dione has potential applications in various fields, such as pharmaceuticals and chemical synthesis.

InChI:InChI=1/C9H14O4/c1-9(2)5-12-7(10)3-4-8(11)13-6-9/h3-6H2,1-2H3

Relevant articles related to 3,3-Dimethyl-1,5-dioxonane-6,9-dione:

5.Reputable manufacturer supply 3,3-Dimethyl-1,5-dioxonane-6,9-dione 7445-18-3 in stock with high standard

Hebei Luspharm Trading Co.,Ltd is a quality supplier of 3,3-Dimethyl-1,5-dioxonane-6,9-dione. Our main goal is customer satisfaction. Contact us to negotiate the best price for your business on 3,3-Dimethyl-1,5-dioxonane-6,9-dione 7445-18-3.